CAS 29724-55-8: (2S,3S,4R,5R)-3-fluoro-2,4,5,6-tetrahydroxy-hexanoic acid

Description:(2S,3S,4R,5R)-3-fluoro-2,4,5,6-tetrahydroxy-hexanoic acid, with CAS number 29724-55-8, is a chiral organic compound characterized by its multiple hydroxyl groups and a fluorine substituent. This compound features a hexanoic acid backbone, which is a six-carbon chain with a carboxylic acid functional group at one end. The presence of four hydroxyl groups contributes to its high polarity, making it soluble in water and potentially reactive in various chemical environments. The specific stereochemistry indicated by the (2S,3S,4R,5R) configuration suggests that the compound has distinct spatial arrangements that can influence its biological activity and interactions with other molecules. The fluorine atom may enhance the compound's stability and alter its reactivity compared to its non-fluorinated counterparts. Overall, this compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and biochemistry, where it may serve as a building block for more complex molecules or as a potential therapeutic agent.

Formula:C₆H₁₁FO₆

InChI:InChI=1/C6H11FO6/c7-3(5(11)6(12)13)4(10)2(9)1-8/h2-5,8-11H,1H2,(H,12,13)/t2-,3+,4-,5-/m1/s1