CAS 29851-57-8: 8-oxoadenosine
Description:8-Oxoadenosine, also known as 8-oxo-adenosine, is a modified nucleoside that plays a significant role in cellular metabolism and signaling. It is derived from adenosine, with an oxygen atom added to the 8th position of the purine ring, resulting in a keto group. This modification can influence its biological activity and stability. 8-Oxoadenosine is known to participate in various biochemical pathways, including those related to oxidative stress and DNA repair, as it can be formed as a result of oxidative damage to nucleotides. Its presence in cells can affect cellular signaling and may be involved in the regulation of gene expression. The compound is soluble in water and exhibits properties typical of nucleosides, such as the ability to form hydrogen bonds. Due to its role in cellular processes, 8-oxoadenosine is of interest in research related to cancer, aging, and neurodegenerative diseases, where oxidative stress plays a critical role.
Formula:C10H13N5O5
InChI:InChI=1/C10H13N5O5/c11-7-4-8(13-2-12-7)15(10(19)14-4)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,14,19)(H2,11,12,13)/t3-,5-,6-,9-/m1/s1
- Synonyms:
- Adenosine, 8-Oxo-
- 6-amino-9-pentofuranosyl-7,9-dihydro-8H-purin-8-one
- 8-Oxoadenosine
