CymitQuimica logo

CAS 29874-83-7

:

2-Chloro-4-phenylquinazoline

Description:
2-Chloro-4-phenylquinazoline is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. The presence of a chlorine atom at the 2-position and a phenyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. It may exhibit various pharmacological effects, including anti-cancer and anti-inflammatory properties, although specific biological activities can vary based on structural modifications and the presence of substituents. The compound is soluble in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 2-Chloro-4-phenylquinazoline serves as a valuable compound in research and development within the field of organic and medicinal chemistry.
Formula:C14H9ClN2
InChI:InChI=1/C14H9ClN2/c15-14-16-12-9-5-4-8-11(12)13(17-14)10-6-2-1-3-7-10/h1-9H
InChI key:SFKMVPQJJGJCMI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c2ccccc2nc(Cl)n1
Synonyms:
  • 2-Chloro-4-phenyl-quinazoline
  • Quinazoline, 2-Chloro-4-Phenyl-
Found 5 products.