CAS 29906-67-0

1-Methyl-5-nitro-1H-indole

Description:

1-Methyl-5-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the nitrogen atom and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically appears as a yellow to orange solid and is sparingly soluble in water but more soluble in organic solvents like ethanol and acetone. It exhibits notable reactivity due to the nitro group, which can participate in various chemical reactions, including reduction and electrophilic substitution. The compound may also display biological activity, making it of interest in medicinal chemistry and research. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, and its structure can influence its interactions in biological systems. Safety precautions should be taken when handling this compound, as nitro-substituted compounds can be hazardous.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-10-5-4-7-6-8(11(12)13)2-3-9(7)10/h2-6H,1H3

SMILES: Cn1ccc2cc(ccc12)N(=O)=O

Synonyms:

• 1H-Indole, 1-methyl-5-nitro-

1-Methyl-5-nitro-1H-indole

CAS: 29906-67-0

1-Methyl-5-nitro-1H-indole

Formula: C₉H₈N₂O₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 176.17202

Ref: 54-OR70135

1-methyl-5-nitro-1H-indole

CAS: 29906-67-0

Formula: C₉H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA007K0W

1-Methyl-5-nitro-1H-indole

CAS: 29906-67-0

Formula: C₉H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.175

Ref: 10-F076555

1-Methyl-5-nitro-1H-indole

Controlled Product

CAS: 29906-67-0

Formula: C₉H₈N₂O₂

Color and Shape: Neat

Molecular weight: 176.17

Ref: TR-M320970