CAS 299165-45-0
:2,3-dihydro-1,4-benzodioxin-6-ylhydrazine
Description:
2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine is an organic compound characterized by its unique structural features, which include a benzodioxin moiety and a hydrazine functional group. This compound typically exhibits a molecular structure that contributes to its potential reactivity and biological activity. It is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the hydrazine group suggests potential for redox activity, while the benzodioxin structure may impart stability and influence solubility. In terms of physical properties, compounds of this nature may be expected to have moderate to low volatility and varying solubility in organic solvents. Safety and handling considerations are essential, as hydrazine derivatives can be toxic and potentially hazardous. Overall, 2,3-dihydro-1,4-benzodioxin-6-ylhydrazine represents a compound of interest in chemical research, particularly in the context of drug discovery and development.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c9-10-6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5,10H,3-4,9H2
SMILES:c1cc2c(cc1NN)OCCO2
Synonyms:- (2,3-Dihydro-Benzo[1,4]Dioxin-6-Yl)-Hydrazine
- Hydrazine, (2,3-Dihydro-1,4-Benzodioxin-6-Yl)-
- 2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine
CAS:2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine
Molecular weight:166.18g/mol

