CAS 2993-24-0
:4-(pentafluoro-lambda~6~-sulfanyl)aniline
Description:
4-(Pentafluoro-lambda^6-sulfanyl)aniline, with the CAS number 2993-24-0, is a chemical compound characterized by the presence of a pentafluorosulfanyl group attached to an aniline structure. This compound features a sulfur atom bonded to five fluorine atoms, which imparts significant electronegativity and unique reactivity to the molecule. The aniline portion of the compound consists of an amino group (-NH2) attached to a benzene ring, which can influence its solubility and reactivity in various chemical environments. The presence of the highly electronegative fluorine atoms can enhance the compound's stability and alter its electronic properties, making it of interest in various applications, including materials science and pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the strong electron-withdrawing nature of the pentafluorosulfanyl group. Overall, 4-(pentafluoro-lambda^6-sulfanyl)aniline represents a unique class of fluorinated compounds with potential utility in advanced chemical applications.
Formula:C6H6F5NS
InChI:InChI=1/C6H6F5NS/c7-13(8,9,10,11)6-3-1-5(12)2-4-6/h1-4H,12H2
SMILES:c1cc(ccc1N)S(F)(F)(F)(F)F
Synonyms:- (4-Aminophenyl)pentafluorosulfur
- 2993-24-0
- 4-(Pentafluoro-lambda6-sulfanyl)aniline
- 4-(Pentafluorosulfur)aniline
- 4-(Pentafluorothio)aniline
- 4-Aminophenylsulfur Pentafluoride
- 4-Aminophenylsulphur pentafluoride
- Sulfur, (4-Aminophenyl)Pentafluoro-
- Zr Dsfffff
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Aminophenylsulfur Pentafluoride
CAS:Formula:C6H6F5NSPurity:>95.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:219.174-Aminophenylsulphur pentafluoride
CAS:4-Aminophenylsulphur pentafluorideFormula:C6H6F5NSPurity:97%Color and Shape:White to brown. Solid-CrystalsMolecular weight:219.1784-AminophenylsulfurPentafluoride
CAS:Formula:C6H6F5NSPurity:97%Color and Shape:SolidMolecular weight:219.17564-Aminophenylsulphur pentafluoride
CAS:Formula:C6H6F5NSPurity:≥95%(GC)Color and Shape:Solid, PowderMolecular weight:219.17(Oc-6-21)-(4-Aminophenyl)Pentafluoro-Sulfur
CAS:(Oc-6-21)-(4-Aminophenyl)Pentafluoro-Sulfur is a synthetic chemical that has the molecular formula of CF5SO2NH. It is a five membered heterocycle with an affinity for chloride ions. The compound was synthesized using phenacyl chloride and chlorosulfonyl fluoride in a one step synthesis. This chemical has shown to be an analog of serotonin with hydrogen bonding capabilities. (Oc-6-21)-(4-Aminophenyl)Pentafluoro-Sulfur can act as both a sensor and an electroneutral chlorine ionophore.Formula:C6H6F5NSPurity:Min. 95%Molecular weight:219.18 g/mol




