CymitQuimica logo

CAS 2993-24-0

:

4-(pentafluoro-lambda~6~-sulfanyl)aniline

Description:
4-(Pentafluoro-lambda^6-sulfanyl)aniline, with the CAS number 2993-24-0, is a chemical compound characterized by the presence of a pentafluorosulfanyl group attached to an aniline structure. This compound features a sulfur atom bonded to five fluorine atoms, which imparts significant electronegativity and unique reactivity to the molecule. The aniline portion of the compound consists of an amino group (-NH2) attached to a benzene ring, which can influence its solubility and reactivity in various chemical environments. The presence of the highly electronegative fluorine atoms can enhance the compound's stability and alter its electronic properties, making it of interest in various applications, including materials science and pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the strong electron-withdrawing nature of the pentafluorosulfanyl group. Overall, 4-(pentafluoro-lambda^6-sulfanyl)aniline represents a unique class of fluorinated compounds with potential utility in advanced chemical applications.
Formula:C6H6F5NS
InChI:InChI=1/C6H6F5NS/c7-13(8,9,10,11)6-3-1-5(12)2-4-6/h1-4H,12H2
InChI key:MZGZUHNSMNNSRJ-UHFFFAOYSA-N
SMILES:c1cc(ccc1N)S(F)(F)(F)(F)F
Synonyms:
  • (4-Aminophenyl)pentafluorosulfur
  • 2993-24-0
  • 4-(Pentafluoro-lambda6-sulfanyl)aniline
  • 4-(Pentafluorosulfur)aniline
  • 4-(Pentafluorothio)aniline
  • 4-Aminophenylsulfur Pentafluoride
  • 4-Aminophenylsulphur pentafluoride
  • Sulfur, (4-Aminophenyl)Pentafluoro-
  • Zr Dsfffff
Found 6 products.