CymitQuimica logo

CAS 299930-70-4

:

3-chloro-1-methyl-4-nitro-1H-pyrazole

Description:
3-Chloro-1-methyl-4-nitro-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring structure, which consists of two adjacent nitrogen atoms within a five-membered ring. The presence of a chlorine atom at the 3-position and a nitro group at the 4-position, along with a methyl group at the 1-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often used in various chemical syntheses and may have applications in agrochemicals or pharmaceuticals due to its potential biological activity. The nitro group can impart electrophilic characteristics, making it a useful intermediate in further chemical transformations. Safety data should be consulted, as compounds with halogen and nitro substituents can pose health and environmental risks. Proper handling and storage conditions are essential to ensure safety when working with this compound.
Formula:C4H4ClN3O2
InChI:InChI=1S/C4H4ClN3O2/c1-7-2-3(8(9)10)4(5)6-7/h2H,1H3
InChI key:UEDIAFCRVLLBSS-UHFFFAOYSA-N
SMILES:CN1C=C(C(=N1)Cl)[N+](=O)[O-]
Found 4 products.