CymitQuimica logo

CAS 300383-08-8

:

4-Methyl-3-(4-morpholinylsulfonyl)benzoic acid

Description:
4-Methyl-3-(4-morpholinylsulfonyl)benzoic acid, identified by its CAS number 300383-08-8, is a chemical compound characterized by its benzoic acid structure, which features a methyl group and a morpholinylsulfonyl substituent. This compound typically exhibits properties associated with both aromatic and sulfonyl functionalities, contributing to its potential as a pharmaceutical intermediate or active ingredient. The presence of the morpholine ring suggests it may possess basic properties, while the sulfonyl group can enhance solubility and reactivity. The compound is likely to be a solid at room temperature, with moderate to high stability under standard conditions. Its functional groups may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's solubility in various solvents can vary, influencing its application in formulations. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C12H15NO5S
InChI:InChI=1S/C12H15NO5S/c1-9-2-3-10(12(14)15)8-11(9)19(16,17)13-4-6-18-7-5-13/h2-3,8H,4-7H2,1H3,(H,14,15)
InChI key:InChIKey=XWGOGAHEPWTCCH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(C(O)=O)=CC=C1C)N2CCOCC2
Synonyms:
  • 4-Methyl-3-(4-morpholinylsulfonyl)benzoic acid
  • Benzoic acid, 4-methyl-3-(4-morpholinylsulfonyl)-
Found 2 products.