CymitQuimica logo

CAS 301226-25-5

:

tert-Butyl 1-oxa-5-azaspiro[2.4]heptane-5-carboxylate

Description:
Tert-Butyl 1-oxa-5-azaspiro[2.4]heptane-5-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom and an oxygen atom within its framework. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the spirocyclic system often imparts interesting stereochemical properties and can influence biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate polarity due to the ester and nitrogen functionalities, affecting its interactions in various chemical environments. Additionally, the spiro structure may confer rigidity, impacting its conformational flexibility. As with many organic compounds, its stability can be influenced by environmental factors such as temperature and pH. Overall, tert-Butyl 1-oxa-5-azaspiro[2.4]heptane-5-carboxylate represents a class of compounds that may have potential applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C10H17NO3
InChI:InChI=1/C10H17NO3/c1-9(2,3)14-8(12)11-5-4-10(6-11)7-13-10/h4-7H2,1-3H3
InChI key:ZFNBSKYWLUKRRV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(C1)CO2
Synonyms:
  • 1-Oxa-5-azaspiro[2.4]heptane-5-carboxylic acid 1,1-dimethylethyl ester
Found 4 products.