CAS 30195-30-3
:7-Chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-2H-1,4-benzodiazepin-2-one
Description:
7-Chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-2H-1,4-benzodiazepin-2-one, with CAS number 30195-30-3, is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This compound features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, with a chlorine substituent at the 7-position and a pyrrole moiety at the 5-position. The presence of the chlorine atom typically enhances the compound's biological activity and lipophilicity. The pyrrole group may contribute to its pharmacological profile, potentially influencing receptor interactions. This compound is of interest in medicinal chemistry for its potential therapeutic applications, particularly in the fields of psychiatry and neurology. Its properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many benzodiazepines, it may exhibit anxiolytic, sedative, or anticonvulsant effects, although specific biological activities would require empirical investigation.
Formula:C13H10ClN3O
InChI:InChI=1S/C13H10ClN3O/c14-8-3-4-10-9(6-8)13(11-2-1-5-15-11)16-7-12(18)17-10/h1-6,15H,7H2,(H,17,18)
InChI key:InChIKey=XWNMORIHKRROGW-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=NCC(=O)NC2=CC1)C3=CC=CN3
Synonyms:- 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-5-pyrrol-2-yl-
- 2H-1,4-benzodiazepin-2-one, 7-chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-
- 7-Chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-2H-1,4-benzodiazepin-2-one
- NSC 66020
- Ro 5-3335
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-2H-1,4-benzodiazepin-2-one
CAS:Formula:C13H10ClN3OPurity:%Color and Shape:SolidMolecular weight:259.6910Ro 5-3335
CAS:Formula:C13H10ClN3OPurity:>98.0%(HPLC)Color and Shape:White to Light red to Green powder to crystalMolecular weight:259.69Ro5-3335
CAS:Ro5-3335 (CBFβ-Runx1 inhibitor II) is core binding factor (CBF) inhibitor; preferentially kills human leukemia cell lines with CBF fusion proteins.Formula:C13H10ClN3OPurity:99.42% - 99.87%Color and Shape:SolidMolecular weight:259.697-Chloro-1,3-dihydro-5-(1H-pyrrol-2-yl)-2H-1,4-benzodiazepin-2-one
CAS:Purity:≥98%(HPLC)Molecular weight:259.6900024Ro 5-3335
CAS:Ro 5-3335 is a synthetic substance that inhibits the production of tumor necrosis factor-α (TNF-α), which is a cytokine that has been shown to induce choroidal neovascularization. Ro 5-3335 has synergistic effects with other drugs such as fluorescein, which can be used to study the progression of choroidal neovascularization in vivo. The anti-inflammatory effect of Ro 5-3335 may be due to its ability to inhibit the synthesis of TNF-α by binding to TNF-α response elements on DNA. This drug also induces cell death by inhibiting growth factor or messenger RNA production or by acting on specific cells such as toll-like receptor 2 and 4.Formula:C13H10ClN3OPurity:Min. 95%Molecular weight:259.69 g/mol





