CymitQuimica logo

CAS 302577-73-7

:

Ethyl 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-propanoate

Description:
Ethyl 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-propanoate is a boron-containing organic compound characterized by its unique dioxaborolane ring structure, which contributes to its reactivity and stability. This compound features a propanoate ester functional group, enhancing its solubility in organic solvents and making it useful in various chemical applications. The presence of multiple methyl groups on the dioxaborolane ring increases steric hindrance, which can influence its reactivity and interactions with other molecules. Typically, compounds like this are utilized in organic synthesis, particularly in the formation of carbon-boron bonds, which are valuable in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific properties such as moderate volatility and potential sensitivity to moisture, necessitating careful handling and storage. Overall, its unique structure and functional groups make it a versatile reagent in synthetic organic chemistry.
Formula:C11H21BO4
InChI:InChI=1S/C11H21BO4/c1-6-14-9(13)7-8-12-15-10(2,3)11(4,5)16-12/h6-8H2,1-5H3
InChI key:InChIKey=OSBBNOTZLRIDPR-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)B1OC(C)(C)C(C)(C)O1
Synonyms:
  • 1,3,2-Dioxaborolane-2-propanoic acid, 4,4,5,5-tetramethyl-, ethyl ester
  • Ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate
  • Ethyl 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-propanoate
  • Ethyl3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate
Found 6 products.