CAS 3027-36-9
:1,3-Benzenedicarbonyl diazide
Description:
1,3-Benzenedicarbonyl diazide, with the CAS number 3027-36-9, is an organic compound characterized by the presence of two azide functional groups (-N3) attached to a benzene ring that also contains two carbonyl groups (C=O). This compound is typically a crystalline solid and is known for its high sensitivity and potential explosiveness, particularly when subjected to heat, shock, or friction. The presence of multiple azide groups contributes to its energetic properties, making it of interest in the field of materials science and explosives. Additionally, the carbonyl groups can influence its reactivity and stability, potentially participating in further chemical reactions. Due to its hazardous nature, handling and storage of 1,3-benzenedicarbonyl diazide require strict safety precautions to prevent accidental detonation or exposure. Its applications may be limited to specialized fields, such as in the development of propellants or other energetic materials, where controlled reactivity is essential.
Formula:C8H4N6O2
InChI:InChI=1S/C8H4N6O2/c9-13-11-7(15)5-2-1-3-6(4-5)8(16)12-14-10/h1-4H
InChI key:InChIKey=OYSSCEMVGJEQHM-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])(=O)C1=CC(C(N=[N+]=[N-])=O)=CC=C1
Synonyms:- 1,3-Benzenedicarbonyl diazide
- Isophthaloyl diazide
- Isophthaloyl azide
- Isophthalic acid diazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
