CymitQuimica logo

CAS 302841-86-7

:

Carbamic acid, (diphenylacetyl)-, ethyl ester

Description:
Carbamic acid, (diphenylacetyl)-, ethyl ester, identified by CAS number 302841-86-7, is an organic compound characterized by its ester functional group and the presence of a carbamic acid moiety. This compound typically exhibits a moderate level of solubility in organic solvents, reflecting its ester nature. It is often used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate in various chemical reactions. The diphenylacetyl group contributes to its unique reactivity and may influence its biological activity. As with many carbamates, it may exhibit properties such as moderate toxicity, necessitating careful handling and storage. The compound's stability can be affected by environmental factors such as pH and temperature, which are important considerations in its application and use. Overall, carbamic acid, (diphenylacetyl)-, ethyl ester is a versatile compound with significant relevance in chemical synthesis and research.
Formula:C17H17NO3
InChI:InChI=1S/C17H17NO3/c1-2-21-17(20)18-16(19)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,2H2,1H3,(H,18,19,20)
InChI key:ILSZPWZFQHSKLW-UHFFFAOYSA-N
SMILES:CCOC(=O)NC(=O)C(C1=CC=CC=C1)C2=CC=CC=C2
Found 4 products.