CymitQuimica logo

CAS 302964-02-9

:

2-[(tert-butoxycarbonyl)amino]-1,3-thiazole-5-carboxylic acid

Description:
2-[(tert-butoxycarbonyl)amino]-1,3-thiazole-5-carboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a tert-butoxycarbonyl (Boc) protecting group on the amino group, which is commonly used in organic synthesis to protect amines during reactions. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical processes. The thiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in the synthesis of bioactive molecules. Additionally, the compound's solubility and stability can be influenced by the Boc group, which can be removed under specific conditions to reveal the free amine for further reactions. Overall, this compound exemplifies the intersection of organic synthesis and pharmaceutical chemistry, showcasing the importance of functional group manipulation in creating complex molecules.
Formula:C9H12N2O4S
InChI:InChI=1/C9H12N2O4S/c1-9(2,3)15-8(14)11-7-10-4-5(16-7)6(12)13/h4H,1-3H3,(H,12,13)(H,10,11,14)
InChI key:QNFLEDLPOVONCN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1ncc(C(=O)O)s1)O
Synonyms:
  • 2-N-Boc-amino-thiazole-5-carboxylic acid
  • 2-tert-Butoxycarbonylamino-thiazole-5-carboxylic acid
Found 6 products.