CymitQuimica logo

CAS 3030-06-6

:

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate

Description:
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate, with the CAS number 3030-06-6, is a chemical compound that belongs to the indole family, characterized by its complex aromatic structure. This compound features a bromine and a chlorine substituent on the indole ring, which can influence its reactivity and biological activity. The presence of the acetyl and acetate functional groups suggests that it may exhibit properties typical of acetylated compounds, such as enhanced lipophilicity and potential for biological activity. The halogen substituents can also impart unique electronic properties, potentially affecting the compound's interaction with biological targets. This compound may be of interest in medicinal chemistry and research due to its structural features, which could lead to various pharmacological effects. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including halogenation and acetylation reactions. Overall, 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate represents a versatile scaffold for further chemical exploration and potential applications in drug development.
Formula:C12H9BrClNO3
InChI:InChI=1S/C12H9BrClNO3/c1-6(16)15-5-10(18-7(2)17)11-9(15)4-3-8(13)12(11)14/h3-5H,1-2H3
InChI key:InChIKey=DSHQTSIXXYZXGR-UHFFFAOYSA-N
SMILES:O(C(C)=O)C=1C=2C(N(C(C)=O)C1)=CC=C(Br)C2Cl
Synonyms:
  • Indol-3-ol, 1-acetyl-5-bromo-4-chloro-, acetate (ester)
  • Ethanone, 1-[3-(acetyloxy)-5-bromo-4-chloro-1H-indol-1-yl]-
  • Indoxyl, 1-acetyl-5-bromo-4-chloro-, acetate
  • Indol-3-ol, 1-acetyl-5-bromo-4-chloro-, acetate
  • 1H-Indol-3-ol, 1-acetyl-5-bromo-4-chloro-, acetate (ester)
Found 8 products.