CymitQuimica logo

CAS 303031-43-8

:

N-benzyl-5-bromopyridine-3-carboxamide

Description:
N-benzyl-5-bromopyridine-3-carboxamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a carboxamide functional group. The presence of the benzyl group enhances its lipophilicity, potentially influencing its biological activity and solubility properties. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals due to its potential as a bioactive molecule. The bromine atom can serve as a useful handle for further chemical modifications, making it a versatile intermediate in synthetic pathways. Additionally, the carboxamide group may contribute to hydrogen bonding interactions, affecting the compound's reactivity and interaction with biological targets. Overall, N-benzyl-5-bromopyridine-3-carboxamide exhibits characteristics that make it of interest in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise information.
Formula:C13H11BrN2O
InChI:InChI=1/C13H11BrN2O/c14-12-6-11(8-15-9-12)13(17)16-7-10-4-2-1-3-5-10/h1-6,8-9H,7H2,(H,16,17)
InChI key:CTVYYGDKDNYJPO-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN=C(c1cc(cnc1)Br)O
Synonyms:
  • 3-Pyridinecarboxamide, 5-bromo-N-(phenylmethyl)-
  • N-Benzyl-5-bromonicotinamide
Found 4 products.