CymitQuimica logo

CAS 303111-96-8

:

Phosphine, dicyclohexyl[2,4,6-tris(1-methylethyl)phenyl]-

Description:
Phosphine, dicyclohexyl[2,4,6-tris(1-methylethyl)phenyl]- is a phosphine compound characterized by its complex organic structure. It features a central phosphorus atom bonded to two cyclohexyl groups and a bulky tri-substituted phenyl group, where the phenyl ring is further substituted with three isopropyl groups at the 2, 4, and 6 positions. This sterically hindered structure contributes to its unique chemical properties, including its potential use as a ligand in coordination chemistry and catalysis. The presence of the bulky isopropyl groups enhances its stability and solubility in organic solvents, making it suitable for various applications in organic synthesis and materials science. Additionally, phosphines are known for their ability to act as nucleophiles and can participate in a variety of chemical reactions, including oxidation and coordination with metals. Safety considerations should be taken into account, as phosphines can be toxic and require proper handling and storage protocols. Overall, this compound exemplifies the diverse functionality and utility of phosphine derivatives in modern chemistry.
Formula:C27H45P
InChI:InChI=1S/C27H45P/c1-19(2)22-17-25(20(3)4)27(26(18-22)21(5)6)28(23-13-9-7-10-14-23)24-15-11-8-12-16-24/h17-21,23-24H,7-16H2,1-6H3
InChI key:DTSPXGRQYHLKLO-UHFFFAOYSA-N
SMILES:CC(C)C1=CC(=C(C(=C1)C(C)C)P(C2CCCCC2)C3CCCCC3)C(C)C
Synonyms:
  • Dicyclohexyl(2,4,6-triisopropylphenyl)phosphine
  • (2,4,6-Tri-isopropyl)phenyl)di-cyclohexylphosphine
Found 6 products.