CymitQuimica logo

CAS 303127-79-9

:

4-methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-beta-D-glucopyranoside

Description:
4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-beta-D-glucopyranoside is a glycoside compound characterized by its complex structure, which includes a glucopyranoside moiety with multiple acetyl groups and a benzyl group. The presence of the methoxyphenyl group contributes to its aromatic characteristics, while the acetyl groups enhance its solubility and stability. This compound is typically used in organic synthesis and may serve as a building block in the development of more complex molecules, particularly in the field of medicinal chemistry. Its beta-D-glucopyranoside configuration indicates that the glucose unit is in the beta anomeric form, which can influence its biological activity and interactions. The compound's CAS number, 303127-79-9, allows for easy identification and reference in chemical databases. Overall, this substance exhibits properties typical of glycosides, including potential reactivity in glycosylation reactions and interactions with biological systems, making it of interest in various research applications.
Formula:C26H30O10
InChI:InChI=1/C26H30O10/c1-16(27)31-15-22-23(33-17(2)28)24(32-14-19-8-6-5-7-9-19)25(34-18(3)29)26(36-22)35-21-12-10-20(30-4)11-13-21/h5-13,22-26H,14-15H2,1-4H3/t22-,23-,24+,25-,26-/m1/s1
InChI key:MDZXNXKMNWQSDZ-WSGIOKLISA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OCC3=CC=CC=C3)OC(=O)C
Found 5 products.