CymitQuimica logo

CAS 303150-56-3

:

1H-1,2,4-Triazol-3-amine, 5-[[[3-(trifluoromethyl)phenyl]methyl]thio]-

Description:
1H-1,2,4-Triazol-3-amine, 5-[[[3-(trifluoromethyl)phenyl]methyl]thio]- is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features an amine functional group, contributing to its potential reactivity and solubility in various solvents. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. The thioether linkage, indicated by the methylthio group, can also affect the compound's stability and reactivity. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, depending on their specific structure and substituents. The molecular interactions and potential applications can vary widely, making it a subject of interest in medicinal chemistry and material science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H9F3N4S
InChI:InChI=1S/C10H9F3N4S/c11-10(12,13)7-3-1-2-6(4-7)5-18-9-15-8(14)16-17-9/h1-4H,5H2,(H3,14,15,16,17)
InChI key:DUEZMVBYRDSPTL-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)C(F)(F)F)CSC2=NNC(=N2)N
Found 1 products.