CymitQuimica logo

CAS 30318-99-1

:

3-Bromo-4-methylthiophene

Description:
3-Bromo-4-methylthiophene is a heterocyclic organic compound characterized by a five-membered aromatic ring containing both sulfur and bromine substituents. The molecular structure features a thiophene ring, which is a sulfur-containing analog of benzene, with a bromine atom positioned at the 3rd carbon and a methylthio group (-S-CH3) at the 4th carbon. This compound typically exhibits a pale yellow to brownish color and has a distinctive odor. It is soluble in organic solvents such as dichloromethane and ether but has limited solubility in water due to its hydrophobic nature. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including electrophilic substitutions and cross-coupling reactions. Additionally, 3-Bromo-4-methylthiophene can serve as a building block in the synthesis of more complex organic molecules, particularly in the fields of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H5BrS
InChI:InChI=1S/C5H5BrS/c1-4-2-7-3-5(4)6/h2-3H,1H3
InChI key:InChIKey=MBUSOPVRLCFJCS-UHFFFAOYSA-N
SMILES:BrC=1C(C)=CSC1
Synonyms:
  • 3-Methyl-4-bromothiophene
  • 3-Bromo-4-methylthiophene
  • Thiophene, 3-bromo-4-methyl-
Found 5 products.