CAS 303180-11-2
:Pyrazole-3,5-dicarboxylic acid monohydrate
Description:
Pyrazole-3,5-dicarboxylic acid monohydrate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features two carboxylic acid groups (-COOH) located at the 3 and 5 positions of the pyrazole ring, contributing to its acidic properties and potential for forming hydrogen bonds. The presence of a monohydrate indicates that the compound includes one molecule of water per formula unit, which can influence its solubility and stability. Pyrazole derivatives are known for their diverse biological activities, making this compound of interest in medicinal chemistry and material science. Its solubility in polar solvents, such as water, is enhanced due to the carboxylic acid groups, allowing for various applications in synthesis and research. Additionally, the compound's structural features may facilitate interactions with biological targets, potentially leading to pharmacological applications. Overall, Pyrazole-3,5-dicarboxylic acid monohydrate is a versatile compound with significant implications in both chemical research and practical applications.
Formula:C5H4N2O4·H2O
InChI:InChI=1S/C5H4N2O4.H2O/c8-4(9)2-1-3(5(10)11)7-6-2;/h1H,(H,6,7)(H,8,9)(H,10,11);1H2
InChI key:GLINCONFUZIMCN-UHFFFAOYSA-N
SMILES:C1=C(NN=C1C(=O)O)C(=O)O.O
Synonyms:- 3,5-Pyrazoledicarboxylic Acid Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Pyrazole-3,5-dicarboxylic Acid Monohydrate
CAS:Formula:C5H4N2O4·H2OPurity:>98.0%(HPLC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:174.121H-Pyrazole-3,5-dicarboxylic acid monohydrate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H6N2O5Purity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:174.111H-pyrazole-3,5-dicarboxylic acid hydrate
CAS:Formula:C5H6N2O5Purity:97%Color and Shape:SolidMolecular weight:174.11151H-pyrazole-3,5-dicarboxylic acid hydrate
CAS:1H-pyrazole-3,5-dicarboxylic acid hydrateFormula:C5H6N2O5Purity:>98%Molecular weight:174.112Pyrazole-3,5-dicarboxylic Acid Monohydrate
CAS:Pyrazole-3,5-dicarboxylic Acid MonohydrateFormula:C5H4N2O4·H2OPurity:>98%Color and Shape:SolidMolecular weight:174.1111H-Pyrazole-3,5-dicarboxylic acid hydrate
CAS:1H-Pyrazole-3,5-dicarboxylic acid hydrateFormula:C5H6N2O5Purity:97%Molecular weight:174.111H-Pyrazole-3,5-dicarboxylic acid hydrate
CAS:Formula:C5H6N2O5Purity:97%Color and Shape:SolidMolecular weight:174.1123,5-Pyrazoledicarboxylic acid monhydrate
CAS:3,5-Pyrazoledicarboxylic acid monhydrate (PDA) is a hydrogen-bonding molecule that can be used for the production of various compounds. PDA can be synthesized in a stepwise process from 3,5-dihydroxypyridine and pyrazole. In this process, the first step involves the formation of an amide bond between 3,5-dihydroxypyridine and pyrazole to form 3,5-pyrazolidinecarboxamide. The second step is the dehydrogenation of 3,5-pyrazolidinecarboxamide to form PDA with loss of one water molecule. This compound shows photocatalytic activity due to its coordination chemistry properties.Formula:C5H4N2O4·H2OPurity:Min. 95%Color and Shape:White PowderMolecular weight:174.11 g/molRef: 3D-FP32326
Discontinued product






