CAS 3032-32-4
:2-AMINO-3,6-DICHLOROBENZOIC ACID
Description:
2-Amino-3,6-dichlorobenzoic acid, with the CAS number 3032-32-4, is an aromatic carboxylic acid characterized by the presence of both amino and dichloro substituents on a benzene ring. This compound features an amino group (-NH2) at the 2-position and two chlorine atoms at the 3 and 6 positions of the benzene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functional group. The presence of chlorine atoms enhances its reactivity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, its structural characteristics may lead to specific interactions in biological systems, which could be relevant for drug design or environmental studies.
Formula:C7H5Cl2NO2
InChI:InChI=1/C7H5Cl2NO2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,10H2,(H,11,12)
SMILES:c1cc(c(c(c1Cl)C(=O)O)N)Cl
Synonyms:- Buttpark 49\07-44
- 3,6-Dichloroanthranilic acid
- 2-Amino-3,6-Dichlobenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Amino-3,6-dichlorobenzoic acid, 95%
CAS:2-Amino-3,6-dichlorobenzoic acid is used as a pharmaceutical intermediate and also finds use in chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origFormula:C7H5Cl2NO2Purity:95%Color and Shape:Pale cream to cream to yellow to brown, Powder or granulesMolecular weight:206.032-Amino-3,6-dichlorobenzoic acid
CAS:2-Amino-3,6-dichlorobenzoic acidFormula:C7H5Cl2NO2Purity:97%Molecular weight:206.03Benzoic acid, 2-amino-3,6-dichloro-
CAS:Formula:C7H5Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:206.02612-Amino-3,6-dichlorobenzoic acid
CAS:2-Amino-3,6-dichlorobenzoic acid
Purity:97%Molecular weight:206.03g/mol2-Amino-3,6-dichlorobenzoic acid
CAS:Formula:C7H5Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:206.022-Amino-3,6-dichlorobenzoic Acid
CAS:Controlled ProductApplications 2-Amino-3,6-dichlorobenzoic Acid is a reagent used in the synthesis of 3-Kinase inhibitors with improved metabolic stability.
References Patel, L. et al.: J. Med. Chem., 59, 9228 (2016);Formula:C7H5Cl2NO2Color and Shape:NeatMolecular weight:206.032-Amino-3,6-dichlorobenzoic acid
CAS:2-Amino-3,6-dichlorobenzoic acid is a synthetic compound that has been used as a pesticide and in the manufacture of dyes. It has also been used to synthesize other compounds such as amino acids, pharmaceuticals, and other organic molecules. The chemical structure of this substance is similar to the natural amino acids phenylalanine and tyrosine. 2-Amino-3,6-dichlorobenzoic acid is synthesized by reacting an amine with nitrous acid and chlorine gas in the presence of a solid catalyst. It can be crystallized from water or alcohol solutions. 2-Amino-3,6-dichlorobenzoic acid can be deformed by heat or light exposure or by oxidation.Formula:C7H5Cl2NO2Purity:Min. 95%Molecular weight:206.03 g/mol






