CAS 3034-04-6
:6-methoxyflavanone
Description:
6-Methoxyflavanone is a flavonoid compound characterized by its structure, which includes a flavanone backbone with a methoxy group attached at the 6-position. This compound typically exhibits a yellow to pale yellow color and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. The presence of the methoxy group can influence its reactivity and interaction with biological systems. Additionally, 6-methoxyflavanone may be involved in various metabolic pathways and can be derived from natural sources, particularly in plants. Its molecular formula reflects the presence of carbon, hydrogen, and oxygen atoms, typical of flavonoids, which are widely studied for their health benefits and roles in plant physiology. As with many flavonoids, further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3/t16-/m1/s1
SMILES:COc1ccc2c(c1)C(=O)C[C@H](c1ccccc1)O2
Synonyms:- 2,3-Dihydro-6-methoxy-2-phenyl-4H-1-benzopyran-4-one
- Nsc 50184
- 4H-1-Benzopyran-4-one, 2,3-dihydro-6-methoxy-2-phenyl-
- 6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
- (2S)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
- (2R)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
- 6-Methoxyflavanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Methoxyflavanone
CAS:Formula:C16H14O3Purity:>98.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:254.296-Methoxyflavanone
CAS:6-Methoxyflavanone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H14O3Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:254.294H-1-Benzopyran-4-one, 2,3-dihydro-6-methoxy-2-phenyl-
CAS:Formula:C16H14O3Purity:98.0%Color and Shape:SolidMolecular weight:254.28066-Methoxy-2-Phenylchroman-4-One
CAS:6-Methoxy-2-Phenylchroman-4-OneFormula:C16H14O3Purity:98%Molecular weight:254.286-Methoxyflavanone
CAS:6-Methoxyflavanone (6-MeOF) is A positive allosteric modulator of the GABA response of human recombinant GABA A receptor, with antianxiety and anti-inflammatoryFormula:C16H14O3Purity:99.86%Color and Shape:Slightly Yellowish-Green Crystalline PowderMolecular weight:254.286-Methoxyflavanone
CAS:6-Methoxyflavanone is a naturally occurring flavonoid compound, which is typically derived from plant sources, particularly those high in flavonoids such as certain fruits and herbs. The compound is characterized by the presence of a methoxy group, which distinguishes it from other flavanones and may influence its bioactivity and solubility properties. Its mode of action often involves interactions with biological pathways that regulate inflammation, oxidative stress, and cellular metabolism, potentially through mechanisms such as enzyme inhibition or modulation of receptor activity.Formula:C16H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:254.28 g/mol






