CymitQuimica logo

CAS 303752-38-7

:

Bicyclo[1.1.1]pentane-1-carboxylic acid,3-[[(1,1-dimethylethoxy)carbonyl]amino]-

Description:
Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]- is a chemical compound characterized by its bicyclic structure, which consists of a bicyclo[1.1.1]pentane core. This compound features a carboxylic acid functional group at one position and an amine derivative at another, specifically an amino group that is further substituted with a tert-butoxycarbonyl (Boc) protecting group. The presence of the carboxylic acid indicates potential acidity and reactivity in various chemical reactions, while the Boc group serves as a protective moiety, commonly used in organic synthesis to shield amines from undesired reactions. The compound's unique bicyclic framework contributes to its rigidity and may influence its physical properties, such as boiling and melting points, as well as its reactivity. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Overall, its structural features suggest potential applications in synthetic chemistry and pharmaceuticals.
Formula:C11H17NO4
InChI:InChI=1S/C11H17NO4/c1-9(2,3)16-8(15)12-11-4-10(5-11,6-11)7(13)14/h4-6H2,1-3H3,(H,12,15)(H,13,14)
InChI key:CKXLBAVWWJDBHS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC12CC(C1)(C2)C(=O)O
Synonyms:
  • 3-((Tert-Butoxycarbonyl)Amino)Bicyclo[1.1.1]Pentane-1-Carboxylic Acid
Found 6 products.