CAS 303994-58-3

1-(4-nitrobenzoyl)piperidine-4-carboxylic acid

Description:

1-(4-Nitrobenzoyl)piperidine-4-carboxylic acid is a chemical compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The compound features a nitro group (-NO2) attached to a benzoyl moiety, which contributes to its aromatic properties and potential reactivity. The carboxylic acid functional group (-COOH) at the 4-position of the piperidine ring imparts acidic characteristics, making it soluble in polar solvents and capable of participating in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest that it could interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the nitro group may influence its electronic properties and reactivity, allowing for further functionalization. Overall, 1-(4-nitrobenzoyl)piperidine-4-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and biochemistry.

Formula: C₁₃H₁₄N₂O₅

InChI: InChI=1/C13H14N2O5/c16-12(9-1-3-11(4-2-9)15(19)20)14-7-5-10(6-8-14)13(17)18/h1-4,10H,5-8H2,(H,17,18)

InChI key: VFTSLMZECVJNRT-UHFFFAOYSA-N

SMILES: c1cc(ccc1C(=O)N1CCC(CC1)C(=O)O)N(=O)=O

1-(4-Nitrobenzoyl)-4-piperidinecarboxylic acid

CAS: 303994-58-3

Formula: C₁₃H₁₄N₂O₅

Molecular weight: 278.2607

Ref: IN-DA002ZZQ