CAS 304-91-6
:2-Iodosylbenzoic acid
Description:
2-Iodosylbenzoic acid is an organic compound characterized by the presence of a benzoic acid moiety substituted with an iodosyl group at the ortho position. Its molecular structure features a carboxylic acid functional group (-COOH) and an iodosyl group (-IO) that contributes to its reactivity and potential applications in organic synthesis. This compound is typically a white to off-white solid and is known for its role as an oxidizing agent in various chemical reactions, particularly in the oxidation of alcohols and other functional groups. The presence of iodine in its structure enhances its electrophilic properties, making it useful in synthetic organic chemistry. Additionally, 2-iodosylbenzoic acid is often utilized in the preparation of other iodine-containing compounds and can serve as a reagent in the development of pharmaceuticals and agrochemicals. As with many iodine-containing compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C7H5IO3
InChI:InChI=1S/C7H5IO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4H,(H,9,10)
InChI key:InChIKey=IFPHDUVGLXEIOQ-UHFFFAOYSA-N
SMILES:I(=O)C1=C(C(O)=O)C=CC=C1
Synonyms:- 2-Iodosobenzoic acid
- 2-Iodosylbenzoic Acid
- 3H-1,2-Benziodoxol-1-ium, 3-oxo-, hydroxide
- Benzoic acid, 2-iodosyl-
- Benzoic acid, o-iodoso-
- Iodosobenzoicacid
- NSC 34548
- o-Iodosobenzoic acid
- o-Iodosobenzoic acid 2-Iodosobenzoic acid
- o-Iodosylbenzoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Iodosobenzoic Acid
CAS:Formula:C7H5IO3Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:264.022-Iodosobenzoic acid, 97%
CAS:1-Organosulfonyloxy-1, 2-benziodoxol-3-(1H)-ones (3, 4, 5) can be prepared in one step from 2-iodosobenzoic acid and the corresponding sulfonic acids. 2-carboxydiphenyliodonium salts was prepared by the acid-catalyzed condensation of 2-iodosobenzoic acid with benzene, mesitylene, and cyclohexylbenzeFormula:C7H5IO3Purity:97%Color and Shape:White to cream, PowderMolecular weight:264.022-Iodosobenzoic acid
CAS:2-Iodosobenzoic acidFormula:C7H5IO3Color and Shape:SolidMolecular weight:264.017272-Iodosobenzoic acid
CAS:2-Iodosobenzoic acidFormula:C7H5IO3Purity:98%Color and Shape:SolidMolecular weight:264.01727





