CymitQuimica logo

CAS 3040175-17-2

:

AMG410

Description:
AMG410, with the CAS number 3040175-17-2, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain biological pathways, which may contribute to its efficacy in treating specific diseases. The compound's structure typically includes functional groups that enhance its binding affinity to target proteins, making it a candidate for drug development. AMG410 is often evaluated in preclinical studies to assess its pharmacokinetics, safety profile, and biological activity. Its characteristics, such as solubility, stability, and metabolic pathways, are crucial for determining its viability as a therapeutic agent. As research progresses, further insights into its mechanism of action and potential side effects will be essential for understanding its role in clinical applications. Overall, AMG410 represents a promising avenue in the ongoing search for effective treatments in various medical conditions.
Formula:C31H32ClF2N7O5
InChI:InChI=1S/C31H32ClF2N7O5/c32-22-9-23-20(12-36-39-23)24-19(22)3-1-7-44-30(42)46-18-14-40(6-8-43-15-18)28-21-11-35-27(24)25(34)26(21)37-29(38-28)45-16-31-4-2-5-41(31)13-17(33)10-31/h9,11-12,17-18H,1-8,10,13-16H2,(H,36,39)/t17-,18+,31+/m1/s1
InChI key:FRRZEUVDJRQIGA-QSDPREHASA-N
SMILES:C1CC2=C(C=C3C(=C2C4=NC=C5C(=C4F)N=C(N=C5N6CCOC[C@H](C6)OC(=O)OC1)OC[C@@]78CCCN7C[C@@H](C8)F)C=NN3)Cl
Synonyms:
  • AMG410
Found 4 products.