CymitQuimica logo

CAS 3045-70-3

:

Cyclododecanone, 2-(1-piperidinylmethyl)-, hydrochloride (1:1)

Description:
Cyclododecanone, 2-(1-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclic ketone structure, derived from cyclododecanone, which is a twelve-membered ring compound. The presence of a piperidinylmethyl group indicates that it has a piperidine ring attached to the cyclododecanone, enhancing its potential for biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its molecular structure contributes to its unique chemical properties, including reactivity and interaction with biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H33NO·ClH
InChI:InChI=1S/C18H33NO.ClH/c20-18-13-9-6-4-2-1-3-5-8-12-17(18)16-19-14-10-7-11-15-19;/h17H,1-16H2;1H
InChI key:InChIKey=SRKVMGLOWZGKEJ-UHFFFAOYSA-N
SMILES:C(C1C(=O)CCCCCCCCCC1)N2CCCCC2.Cl
Synonyms:
  • Cyclododecanone, 2-(1-piperidinylmethyl)-, hydrochloride (1:1)
  • Cyclododecanone, 2-(piperidinomethyl)-, hydrochloride
  • Cyclododecanone, 2-(1-piperidinylmethyl)-, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.