CymitQuimica logo

CAS 30491-91-9

:

1-Cyanocyclobutanecarboxylic acid

Description:
1-Cyanocyclobutanecarboxylic acid is an organic compound characterized by its unique structure, which includes a cyclobutane ring, a cyano group (-CN), and a carboxylic acid group (-COOH). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of both the cyano and carboxylic acid functional groups contributes to its reactivity, allowing for various chemical transformations. Additionally, 1-cyanocyclobutanecarboxylic acid may exhibit polar characteristics due to the functional groups, influencing its solubility in polar solvents. Safety data indicates that, like many cyanide-containing compounds, it should be handled with care due to potential toxicity. Overall, this compound is of interest in the field of synthetic organic chemistry for its versatile reactivity and potential applications.
Formula:C6H7NO2
InChI:InChI=1S/C6H7NO2/c7-4-6(5(8)9)2-1-3-6/h1-3H2,(H,8,9)
InChI key:InChIKey=UMPNPEAXNWBDME-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C#N)CCC1
Synonyms:
  • 1-Cyanocyclobutanecarboxylic acid
  • Cyclobutanecarboxylic acid, 1-cyano-
  • 1-Cyanocyclobutane-1-carboxylic acid
Found 5 products.