CymitQuimica logo

CAS 305329-97-9

:

tert-Butyl 3-(bromomethyl)pyrrolidine-1-carboxylate

Description:
Tert-Butyl 3-(bromomethyl)pyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The bromomethyl group introduces a reactive site, allowing for further chemical modifications or reactions, such as nucleophilic substitution. The carboxylate functional group contributes to the compound's acidity and can participate in various chemical reactions, including esterification and amidation. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its stability under standard conditions makes it a useful building block in synthetic chemistry. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, tert-Butyl 3-(bromomethyl)pyrrolidine-1-carboxylate is a versatile compound with significant utility in chemical research and development.
Formula:C10H18BrNO2
InChI:InChI=1S/C10H18BrNO2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-7H2,1-3H3
InChI key:NQNGQGISAMHLST-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(C1)CBr
Synonyms:
  • 1-Boc-3-bromomethyl-pyrrolidine
Found 4 products.