CymitQuimica logo

CAS 3060-46-6

:

N-methyl-L-leucine

Description:
N-methyl-L-leucine is an amino acid derivative characterized by the presence of a methyl group attached to the nitrogen atom of the leucine side chain. It is a chiral compound, existing in two enantiomeric forms, with the L-form being biologically relevant. This substance is soluble in water and exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation. N-methyl-L-leucine is often used in biochemical research and pharmaceutical applications, particularly in studies related to protein synthesis and enzyme activity. Its structural features contribute to its role in influencing the conformation and stability of peptides and proteins. Additionally, it may serve as a building block in the synthesis of more complex molecules. The compound is generally stable under standard conditions, but like many amino acids, it can be sensitive to extreme pH levels and temperatures. Overall, N-methyl-L-leucine is an important compound in the field of biochemistry, with implications for both research and therapeutic applications.
Formula:C7H15NO2
InChI:InChI=1/C7H15NO2/c1-5(2)4-6(8-3)7(9)10/h5-6,8H,4H2,1-3H3,(H,9,10)/t6-/m0/s1
InChI key:XJODGRWDFZVTKW-LURJTMIESA-N
SMILES:CC(C)C[C@@H](C(=O)O)NC
Synonyms:
  • leucine, N-methyl-
  • N-methylleucine
Found 6 products.