CymitQuimica logo

CAS 3062-07-5

:

val-glu

Description:
Val-glu, also known as Valine-Glutamic acid, is a dipeptide composed of the amino acids valine and glutamic acid. It is characterized by its specific sequence, where valine is linked to glutamic acid through a peptide bond. This compound is notable for its role in various biological processes, including protein synthesis and metabolic pathways. Val-glu exhibits properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of functional groups like amino and carboxyl groups. Its structure contributes to its functionality in biological systems, influencing protein folding and interactions. Additionally, val-glu may have implications in nutrition and health, as it can serve as a building block for proteins and play a role in cellular signaling. The CAS number 3062-07-5 uniquely identifies this compound in chemical databases, facilitating research and application in fields such as biochemistry and pharmacology.
Formula:C10H18N2O5
InChI:InChI=1S/C10H18N2O5/c1-5(2)8(11)9(15)12-6(10(16)17)3-4-7(13)14/h5-6,8H,3-4,11H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)/t6-,8-/m0/s1
InChI key:UPJONISHZRADBH-XPUUQOCRSA-N
SMILES:CC(C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N
Synonyms:
  • H-Val-Glu-OH
Found 6 products.