CymitQuimica logo

CAS 30651-24-2

:

5-Nitropyridine-2-carboxylic acid

Description:
5-Nitropyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a nitro group (-NO2) at the 5-position and a carboxylic acid group (-COOH) at the 2-position of the pyridine ring, contributing to its acidic properties. It is typically a yellow to orange crystalline solid, soluble in polar solvents like water and alcohols, due to the presence of the carboxylic acid functional group. The nitro group enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound exhibits typical characteristics of nitro-substituted aromatic compounds, such as increased electrophilicity and potential for further functionalization. Additionally, it may display biological activity, which is of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C6H4N2O4
InChI:InChI=1/C6H4N2O4/c9-6(10)5-2-1-4(3-7-5)8(11)12/h1-3H,(H,9,10)
InChI key:QKYRCTVBMNXTBT-UHFFFAOYSA-N
SMILES:c1cc(C(=O)O)ncc1N(=O)=O
Synonyms:
  • 5-Nitro-2-picolinic acid
  • 3-Nitro-6-pyridinecarboxylic acid
Found 6 products.