CAS 307-37-9
:1H,1H-Perfluoro-1-decanol
Description:
1H,1H-Perfluoro-1-decanol, with the CAS number 307-37-9, is a perfluorinated alcohol characterized by a long carbon chain and fluorinated substituents. This compound features a decanol backbone, where all hydrogen atoms are replaced by fluorine atoms, except for the hydroxyl (-OH) group at one end. This unique structure imparts several notable properties, including high hydrophobicity and lipophobicity, making it resistant to water and oils. The presence of the hydroxyl group allows for some degree of solubility in polar solvents, although it remains predominantly non-polar. Additionally, 1H,1H-Perfluoro-1-decanol exhibits thermal stability and chemical inertness, which makes it useful in various applications, including surfactants, coatings, and as a potential additive in formulations requiring low surface tension. Its environmental impact is a consideration, as perfluorinated compounds are known for their persistence in the environment. Overall, this compound's unique properties make it valuable in specialized industrial applications while also raising concerns regarding its ecological footprint.
Formula:C10H3F19O
InChI:InChI=1/C10H3F19O/c11-2(12,1-30)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h30H,1H2
SMILES:C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
Synonyms:- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecan-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1H,1H-Nonadecafluoro-1-decanol
CAS:Formula:C10H3F19OPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:500.101H,1H-Perfluoro-1-decanol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H3F19OPurity:98%Color and Shape:White or colorless to pale cream, Powder or crystalline powder or crystalsMolecular weight:500.101-Decanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-
CAS:Formula:C10H3F19OPurity:98%Color and Shape:SolidMolecular weight:500.09991H,1H-Perfluorodecan-1-ol
CAS:1H,1H-Perfluorodecan-1-olFormula:C10H3F19OPurity:98%Color and Shape: colourless to white crystalsMolecular weight:500.09988g/mol1H,1H-Perfluoro-1-decanol
CAS:Controlled ProductApplications 1H,1H-Perfluoro-1-decanol (cas# 307-37-9) is a useful research chemical.
Formula:C10H3OF19Color and Shape:Off-WhiteMolecular weight:500.11H,1H-Perfluoro-1-decanol
CAS:Formula:C10H3F19OPurity:98.0%Color and Shape:SolidMolecular weight:500.103






