CymitQuimica logo

CAS 307-37-9

:

1H,1H-Perfluoro-1-decanol

Description:
1H,1H-Perfluoro-1-decanol, with the CAS number 307-37-9, is a perfluorinated alcohol characterized by a long carbon chain and fluorinated substituents. This compound features a decanol backbone, where all hydrogen atoms are replaced by fluorine atoms, except for the hydroxyl (-OH) group at one end. This unique structure imparts several notable properties, including high hydrophobicity and lipophobicity, making it resistant to water and oils. The presence of the hydroxyl group allows for some degree of solubility in polar solvents, although it remains predominantly non-polar. Additionally, 1H,1H-Perfluoro-1-decanol exhibits thermal stability and chemical inertness, which makes it useful in various applications, including surfactants, coatings, and as a potential additive in formulations requiring low surface tension. Its environmental impact is a consideration, as perfluorinated compounds are known for their persistence in the environment. Overall, this compound's unique properties make it valuable in specialized industrial applications while also raising concerns regarding its ecological footprint.
Formula:C10H3F19O
InChI:InChI=1/C10H3F19O/c11-2(12,1-30)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h30H,1H2
InChI key:NIRPXSQCRWXHNZ-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
Synonyms:
  • 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecan-1-Ol
Found 7 products.