CAS 307002-71-7
:N-(4-morpholinobutyl)benzofuran-2-carboxamide hydrochloride
Description:
N-(4-morpholinobutyl)benzofuran-2-carboxamide hydrochloride is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and a morpholine group. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the hydrochloride salt form. It may possess biological activity, potentially acting as a pharmacological agent due to its structural features that allow for interactions with biological targets. The morpholine ring contributes to its ability to form hydrogen bonds, enhancing its solubility and reactivity. Additionally, the carboxamide functional group may play a role in its stability and interaction with other molecules. As with many compounds, its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Safety data sheets and handling guidelines should be consulted for information regarding toxicity and safe handling practices. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and drug development.
Formula:C17H23ClN2O3
InChI:InChI=1/C17H22N2O3.ClH/c20-17(16-13-14-5-1-2-6-15(14)22-16)18-7-3-4-8-19-9-11-21-12-10-19;/h1-2,5-6,13H,3-4,7-12H2,(H,18,20);1H
SMILES:c1ccc2c(c1)cc(C(=NCCCCN1CCOCC1)O)o2.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
CL-82198
CAS:CL-82198, a selective MMP-13 inhibitor, serves as a pharmacological intervention to halt the progression of osteoarthritis (OA).Formula:C17H22N2O3Purity:95.91%Color and Shape:SolidMolecular weight:302.37Ref: TM-T14978
5mg44.00€1mL*10mM (DMSO)48.00€10mg70.00€25mg144.00€50mg230.00€100mg358.00€200mg523.00€500mg822.00€2-Benzofurancarboxamide, N-[4-(4-morpholinyl)butyl]-
CAS:Formula:C17H22N2O3Purity:98%Color and Shape:SolidMolecular weight:302.3682CL-82198
CAS:CL-82198 is a potent inhibitor of Toll-like receptor 4 (TLR4) and has been shown to inhibit the growth of cancer cells. It induces the expression of genes that are up-regulated in both bowel disease and cancer tissues, such as collagen, protease activity, and epidermal growth factor. CL-82198 also inhibits the production of inflammatory cytokines such as IL-1β, IL-6, and TNFα. CL-82198 is currently being studied for its potential use in the treatment of diabetic neuropathy and inflammatory bowel disease.Formula:C17H22N2O3Purity:Min. 95%Molecular weight:302.37 g/mol




