CymitQuimica logo

CAS 307297-39-8

:

L-Alanyl-L-glutamyl-L-aspartyl-glycine

Description:
L-Alanyl-L-glutamyl-L-aspartyl-glycine, with the CAS number 307297-39-8, is a synthetic peptide composed of four amino acids: alanine, glutamic acid, aspartic acid, and glycine. This peptide is characterized by its specific sequence, which influences its biological activity and interactions. It is typically soluble in water, making it suitable for various biochemical applications. The presence of multiple amino acid residues allows for potential interactions with receptors and enzymes, which may be relevant in pharmacological studies or therapeutic applications. Peptides like this one can exhibit unique properties such as enhanced stability, bioactivity, and the ability to modulate physiological processes. Additionally, the structural configuration of the peptide can affect its conformation and function, making it an interesting subject for research in fields such as biochemistry, molecular biology, and drug development. Overall, L-Alanyl-L-glutamyl-L-aspartyl-glycine represents a complex molecule with potential implications in both scientific research and therapeutic contexts.
Formula:C14H22N4O9
InChI:InChI=1/C14H22N4O9/c1-6(15)12(25)17-7(2-3-9(19)20)14(27)18-8(4-10(21)22)13(26)16-5-11(23)24/h6-8H,2-5,15H2,1H3,(H,16,26)(H,17,25)(H,18,27)(H,19,20)(H,21,22)(H,23,24)/t6-,7-,8-/m0/s1
InChI key:HGHOBRRUMWJWCU-FXQIFTODSA-N
SMILES:C[C@@H](C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CC(=O)O)C(=NCC(=O)O)O)O)O)N
Synonyms:
  • Epithalon
  • Epitalon
  • L-alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
  • Epithalon,EpithalonTetraPeptide
  • Epitalon (Epithalon)
  • See more synonyms
Found 5 products.