CymitQuimica logo

CAS 307307-97-7

:

Pyrazolo[1,5-a]pyridine-3-carboxylicacid, 4,5,6,7-tetrahydro-

Description:
Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 4,5,6,7-tetrahydro- is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The tetrahydro configuration indicates that the compound has a saturated ring structure, which can influence its physical and chemical properties, such as solubility and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the pyrazole moiety often correlates with various pharmacological effects, including anti-inflammatory and analgesic properties. Additionally, the compound's molecular structure allows for potential interactions with biological targets, which can be explored in therapeutic applications. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its reactivity and potential uses in various chemical and pharmaceutical contexts.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h5H,1-4H2,(H,11,12)
InChI key:VOAKNFVZEGNOKV-UHFFFAOYSA-N
SMILES:C1CCN2C(=C(C=N2)C(=O)O)C1
Found 5 products.