CymitQuimica logo

CAS 307341-55-5

:

2-(benzoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid

Description:
2-(Benzoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a cyclopentane moiety. This compound features a benzoylamino group, contributing to its potential as a bioactive molecule. The presence of a carboxylic acid functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. The compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the core structure. Additionally, the compound's CAS number, 307341-55-5, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the complexity and diversity of organic molecules with potential therapeutic applications.
Formula:C15H13NO3S
InChI:InChI=1/C15H13NO3S/c17-13(9-5-2-1-3-6-9)16-14-12(15(18)19)10-7-4-8-11(10)20-14/h1-3,5-6H,4,7-8H2,(H,16,17)(H,18,19)
InChI key:JEEWRTJYBDZVBA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=Nc1c(c2CCCc2s1)C(=O)O)O
Synonyms:
  • 4H-cyclopenta[b]thiophene-3-carboxylic acid, 2-(benzoylamino)-5,6-dihydro-
  • 2-(Benzoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid
Found 2 products.