CAS 3078-34-0
:6B-hydroxycortisol
Description:
6B-hydroxycortisol, with the CAS number 3078-34-0, is a steroid hormone that is a derivative of cortisol, which is a glucocorticoid produced by the adrenal cortex. This compound is characterized by the presence of a hydroxyl group at the 6β position of the steroid nucleus, which influences its biological activity and metabolism. It is involved in various physiological processes, including the regulation of metabolism, immune response, and stress response. 6B-hydroxycortisol is typically found in low concentrations in biological fluids and is often studied in the context of adrenal function and disorders related to cortisol metabolism. Its structural modifications compared to cortisol can affect its binding affinity to glucocorticoid receptors and its overall potency. Analytical methods such as chromatography and mass spectrometry are commonly employed to detect and quantify this compound in research and clinical settings. Understanding its characteristics is essential for exploring its role in health and disease, particularly in conditions related to adrenal hormone regulation.
Formula:C21H30O6
InChI:InChI=1/C21H30O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h7,12-13,15-16,18,22,24-25,27H,3-6,8-10H2,1-2H3/t12?,13?,15?,16?,18?,19?,20?,21-/m0/s1
SMILES:CC12CCC(=O)C=C1C(CC1C3CC[C@](C(=O)CO)(C3(C)CC(C21)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(8S,9S,10R,11S,13S,14S,17R)-6,11,17-Trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one
CAS:Formula:C21H30O6Molecular weight:378.45936-Hydroxycortisol
CAS:6-Hydroxycortisol is a metabolite of Cortisol and can be used as a marker for studying Cortisol metabolism.Formula:C21H30O6Color and Shape:SolidMolecular weight:378.4596β-Hydroxycortisol
CAS:Controlled Product<p>6β-Hydroxycortisol is a metabolite of cortisol, which is a corticosteroid hormone synthesized by the adrenal cortex. This compound is formed in the human body through the process of enzymatic hydroxylation, primarily catalyzed by the cytochrome P450 enzyme CYP3A4. The transformation of cortisol to 6β-Hydroxycortisol is an important pathway for the inactivation of cortisol, altering its physiological activity and aiding in its excretion.</p>Formula:C21H30O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:378.46 g/mol



