CymitQuimica logo

CAS 3078-34-0

:

6B-hydroxycortisol

Description:
6B-hydroxycortisol, with the CAS number 3078-34-0, is a steroid hormone that is a derivative of cortisol, which is a glucocorticoid produced by the adrenal cortex. This compound is characterized by the presence of a hydroxyl group at the 6β position of the steroid nucleus, which influences its biological activity and metabolism. It is involved in various physiological processes, including the regulation of metabolism, immune response, and stress response. 6B-hydroxycortisol is typically found in low concentrations in biological fluids and is often studied in the context of adrenal function and disorders related to cortisol metabolism. Its structural modifications compared to cortisol can affect its binding affinity to glucocorticoid receptors and its overall potency. Analytical methods such as chromatography and mass spectrometry are commonly employed to detect and quantify this compound in research and clinical settings. Understanding its characteristics is essential for exploring its role in health and disease, particularly in conditions related to adrenal hormone regulation.
Formula:C21H30O6
InChI:InChI=1/C21H30O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h7,12-13,15-16,18,22,24-25,27H,3-6,8-10H2,1-2H3/t12?,13?,15?,16?,18?,19?,20?,21-/m0/s1
InChI key:GNFTWPCIRXSCQF-ZHAFKKQJSA-N
SMILES:CC12CCC(=O)C=C1C(CC1C3CC[C@](C(=O)CO)(C3(C)CC(C21)O)O)O
Found 4 products.