CymitQuimica logo

CAS 307989-41-9

:

Benzenamine, 4-methyl-3-(methylsulfonyl)-

Description:
Benzenamine, 4-methyl-3-(methylsulfonyl)-, also known by its CAS number 307989-41-9, is an organic compound characterized by the presence of an aniline structure with a methyl group and a methylsulfonyl group attached to the benzene ring. This compound typically exhibits properties associated with aromatic amines, such as a relatively high boiling point and moderate solubility in polar solvents due to the presence of the sulfonyl group, which can enhance its polarity. The methylsulfonyl group contributes to its potential as a sulfonamide derivative, which may influence its reactivity and interactions in various chemical environments. Additionally, the presence of the amino group can facilitate hydrogen bonding, affecting its physical properties and biological activity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those containing amine functionalities.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-6-3-4-7(9)5-8(6)12(2,10)11/h3-5H,9H2,1-2H3
InChI key:KGJPTUKXABCZOR-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)N)S(=O)(=O)C
Found 5 products.