CAS 30989-06-1

Ethanol, 2-(2-butoxyethoxy)-, triester with boric acid (H3BO3)

Description:

Ethanol, 2-(2-butoxyethoxy)-, triester with boric acid, identified by CAS number 30989-06-1, is a chemical compound that features a triester formation between boric acid and a specific ethanol derivative. This compound typically exhibits characteristics associated with esters, such as being a colorless liquid with a pleasant odor. It is soluble in organic solvents and may have limited solubility in water due to the hydrophobic nature of the butoxyethoxy groups. The presence of boron in its structure suggests potential applications in various fields, including agriculture as a boron nutrient or in materials science for enhancing properties of polymers. Additionally, the compound may exhibit unique reactivity due to the boron moiety, which can participate in coordination chemistry. Safety data should be consulted for handling and exposure guidelines, as esters can vary in toxicity and environmental impact. Overall, this compound represents a specialized class of boron-containing esters with potential utility in diverse applications.

Formula: C₂₄H₅₁BO₉

InChI: InChI=1S/C24H51BO9/c1-4-7-10-26-13-16-29-19-22-32-25(33-23-20-30-17-14-27-11-8-5-2)34-24-21-31-18-15-28-12-9-6-3/h4-24H2,1-3H3

InChI key: InChIKey=QHQSMPZSVCLFEQ-UHFFFAOYSA-N

SMILES: B(OCCOCCOCCCC)(OCCOCCOCCCC)OCCOCCOCCCC

Synonyms:

• Ethanol, 2-(2-butoxyethoxy)-, triester with boric acid (H3BO3)

Ethanol, 2-(2-butoxyethoxy)-, triester with boric acid (H3BO3)

CAS: 30989-06-1

Formula: C₂₄H₅₁BO₉

Molecular weight: 494.4673

Ref: IN-DA0031TR