CAS 30989-73-2

2-(Diethoxymethyl)-1,1-diethoxyheptane

Description:

2-(Diethoxymethyl)-1,1-diethoxyheptane is an organic compound characterized by its complex structure, which includes multiple ethoxy groups and a heptane backbone. This compound features a branched alkane structure, making it a member of the alkyl ether family. The presence of diethoxymethyl and diethoxy functional groups suggests that it has potential applications in organic synthesis and as a solvent or reagent in chemical reactions. The ethoxy groups contribute to its solubility in organic solvents and may influence its reactivity and stability. Additionally, the compound's molecular structure indicates that it may exhibit properties typical of ethers, such as low volatility and moderate polarity. Safety data for this compound should be consulted, as it may pose health risks if not handled properly. Overall, 2-(Diethoxymethyl)-1,1-diethoxyheptane is a versatile chemical with potential utility in various chemical processes, although specific applications would depend on further research and characterization.

Formula: C₁₆H₃₄O₄

InChI: InChI=1S/C16H34O4/c1-6-11-12-13-14(15(17-7-2)18-8-3)16(19-9-4)20-10-5/h14-16H,6-13H2,1-5H3

InChI key: InChIKey=FYVVSNOKHFMGID-UHFFFAOYSA-N

SMILES: C(C(OCC)OCC)(C(OCC)OCC)CCCCC

Synonyms:

• 2-(Diethoxymethyl)-1,1-diethoxyheptane
• Malonaldehyde, pentyl-, bis(diethyl acetal)
• Heptane, 2-(diethoxymethyl)-1,1-diethoxy-

Heptane, 2-(diethoxymethyl)-1,1-diethoxy-

CAS: 30989-73-2

Formula: C₁₆H₃₄O₄

Molecular weight: 290.4388

Ref: IN-DA0031UR