CAS 309915-37-5

1-(4-fluorobenzyl)piperazin-2-one

Description:

1-(4-Fluorobenzyl)piperazin-2-one is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-fluorobenzyl group enhances its pharmacological properties, making it of interest in medicinal chemistry. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, which is common for many piperazine derivatives. Its molecular structure suggests potential interactions with various biological targets, particularly in the central nervous system, due to the piperazine moiety's known activity as a scaffold in drug design. The fluorine atom can influence the compound's lipophilicity and metabolic stability, potentially affecting its bioavailability and pharmacokinetics. As with many synthetic compounds, safety and handling precautions are essential, as the biological effects and toxicity profiles should be thoroughly evaluated in preclinical studies. Overall, 1-(4-fluorobenzyl)piperazin-2-one represents a versatile structure in the exploration of new therapeutic agents.

Formula: C₁₁H₁₃FN₂O

InChI: InChI=1/C11H13FN2O/c12-10-3-1-9(2-4-10)8-14-6-5-13-7-11(14)15/h1-4,13H,5-8H2

InChI key: SXKHEFKMEKHLAS-UHFFFAOYSA-N

SMILES: c1cc(ccc1CN1CCNCC1=O)F

Synonyms:

• 2-Piperazinone, 1-[(4-Fluorophenyl)Methyl]-

2-Piperazinone, 1-[(4-fluorophenyl)methyl]-

CAS: 309915-37-5

Formula: C₁₁H₁₃FN₂O

Molecular weight: 208.2321

Ref: IN-DA0031UF