CymitQuimica logo

CAS 309938-27-0

:

[1-(2-fluorobenzyl)-1H-benzimidazol-2-yl]methanol

Description:
[1-(2-fluorobenzyl)-1H-benzimidazol-2-yl]methanol, with the CAS number 309938-27-0, is a chemical compound characterized by its unique structure that includes a benzimidazole core substituted with a 2-fluorobenzyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the fluorine atom can enhance lipophilicity and potentially affect biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group may participate in hydrogen bonding, influencing the compound's interactions in biological systems. Additionally, the benzimidazole moiety is known for its diverse pharmacological properties, including antifungal and anticancer activities. Overall, this compound's characteristics suggest potential applications in drug development and research, particularly in areas targeting specific biological pathways or mechanisms. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H13FN2O
InChI:InChI=1/C15H13FN2O/c16-12-6-2-1-5-11(12)9-18-14-8-4-3-7-13(14)17-15(18)10-19/h1-8,19H,9-10H2
InChI key:AQUZVNQMUGYVCL-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)Cn1c2ccccc2nc1CO)F
Synonyms:
  • [1-(2-Fluoro-benzyl)-1H-benzoimidazol-2-yl]-methanol
  • 1H-benzimidazole-2-methanol, 1-[(2-fluorophenyl)methyl]-
Found 3 products.