CAS 309943-02-0

Benzoic acid, 4-[[(4-chlorophenyl)methyl]amino]-3-nitro-

Description:

Benzoic acid, 4-[[(4-chlorophenyl)methyl]amino]-3-nitro- is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a 4-chlorophenylmethylamino group and a nitro group at the meta position. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in organic solvents and potential acidity due to the carboxylic acid functional group. The presence of the nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the chlorophenyl group may impart specific biological activities, making this compound of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antibacterial or anti-inflammatory properties. As with many organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with certain substituents like the nitro and chloro groups.

Formula: C₁₄H₁₁ClN₂O₄

InChI: InChI=1S/C14H11ClN2O4/c15-11-4-1-9(2-5-11)8-16-12-6-3-10(14(18)19)7-13(12)17(20)21/h1-7,16H,8H2,(H,18,19)

InChI key: JAXIFLBRKIYZKE-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1CNC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-])Cl

Benzoic acid, 4-[[(4-chlorophenyl)methyl]amino]-3-nitro-

CAS: 309943-02-0

Formula: C₁₄H₁₁ClN₂O₄

Molecular weight: 306.7011

Ref: IN-DA0031V2