CAS 309947-56-6

Sodium, (4-ethyl-1,1-diphenyloctyl)-

Description:

The chemical substance known as "Sodium, (4-ethyl-1,1-diphenyloctyl)-" with the CAS number 309947-56-6 is a specialized organosodium compound. It typically features a sodium atom bonded to a complex organic structure that includes an ethyl group and diphenyl moieties, contributing to its unique properties. This compound is likely to exhibit characteristics typical of organosodium compounds, such as high reactivity, particularly with moisture and air, due to the presence of sodium. It may serve as a reagent in organic synthesis, particularly in reactions requiring strong bases or nucleophiles. The presence of the bulky diphenyl and ethyl groups may influence its solubility and stability in various solvents. Additionally, safety precautions are essential when handling this compound, as it can be hazardous, potentially causing fire or explosion risks upon contact with water. Overall, while specific applications and behaviors can vary, the compound is indicative of the diverse chemistry associated with organosodium species.

Formula: C₂₂H₂₉Na

InChI: InChI=1S/C22H29.Na/c1-3-5-12-19(4-2)17-18-22(20-13-8-6-9-14-20)21-15-10-7-11-16-21;/h6-11,13-16,19H,3-5,12,17-18H2,1-2H3;/q-1;+1

InChI key: CLZQYKDGOHUBKJ-UHFFFAOYSA-N

SMILES: CCCCC(CC)CC[C-](C1=CC=CC=C1)C2=CC=CC=C2.[Na+]

Sodium, (4-ethyl-1,1-diphenyloctyl)-

CAS: 309947-56-6

Formula: C₂₂H₂₉Na

Molecular weight: 316.4554

Ref: IN-DA0031V1