CymitQuimica logo

CAS 310-93-0

:

8-Oxa-2-aza-spiro[4.5]decane

Description:
8-Oxa-2-aza-spiro[4.5]decane, with the CAS number 310-93-0, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom and an oxygen atom incorporated into its ring system. This compound features a spiro connection between two five-membered rings, contributing to its distinctive three-dimensional conformation. The presence of both nitrogen and oxygen atoms in the structure can influence its chemical reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically colorless to pale yellow and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various functional group modifications, making it a versatile scaffold in synthetic organic chemistry. Additionally, the compound's properties, such as boiling point, melting point, and stability, can vary based on environmental conditions and the presence of substituents. Overall, 8-Oxa-2-aza-spiro[4.5]decane is of interest for its structural features and potential utility in various chemical applications.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-4-9-7-8(1)2-5-10-6-3-8/h9H,1-7H2
InChI key:JVBOTGLQUHBBCV-UHFFFAOYSA-N
SMILES:C1CNCC12CCOCC2
Found 4 products.